C20H23N — CID 71114365
11-methyl-1,2,5,6a,6b,9,10,10a,11,11a-decahydroindeno[1,2-b]carbazole (PubChem CID 71114365) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 11-methyl-1,2,5,6a,6b,9,10,10a,11,11a-decahydroindeno[1,2-b]carbazole.
| Compound Name | 11-methyl-1,2,5,6a,6b,9,10,10a,11,11a-decahydroindeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 71114365 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 11-methyl-1,2,5,6a,6b,9,10,10a,11,11a-decahydroindeno[1,2-b]carbazole |
| SMILES | CC1C2C=c3c4c([nH]c3=CC2C2C=CCCC12)C=CCC4 |
| InChI | InChI=1S/C20H23N/c1-12-13-6-2-3-7-14(13)17-11-20-18(10-16(12)17)15-8-4-5-9-19(15)21-20/h3,5,7,9-14,16-17,21H,2,4,6,8H2,1H3 |
| InChIKey | KBBZAVLIFUKEDR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|