C23H31N — CID 71114366
2-(7-ethyl-9,9-dimethyl-4a,4b,5,6,8a,9a-hexahydrofluoren-2-yl)cyclohexa-1,3-dien-1-amine (PubChem CID 71114366) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-(7-ethyl-9,9-dimethyl-4a,4b,5,6,8a,9a-hexahydrofluoren-2-yl)cyclohexa-1,3-dien-1-amine.
| Compound Name | 2-(7-ethyl-9,9-dimethyl-4a,4b,5,6,8a,9a-hexahydrofluoren-2-yl)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 71114366 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 2-(7-ethyl-9,9-dimethyl-4a,4b,5,6,8a,9a-hexahydrofluoren-2-yl)cyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=CC2C(CC1)C1C=CC(C3=C(N)CCC=C3)=CC1C2(C)C |
| InChI | InChI=1S/C23H31N/c1-4-15-9-11-18-19-12-10-16(17-7-5-6-8-22(17)24)14-21(19)23(2,3)20(18)13-15/h5,7,10,12-14,18-21H,4,6,8-9,11,24H2,1-3H3 |
| InChIKey | QCMXOOVNXHNHBB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|