C25H25FN6OS — CID 71114599
(11R,15S)-5-ethylsulfanyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 71114599) has the molecular formula C25H25FN6OS and a molecular weight of 476.58 g/mol. Its IUPAC name is (11R,15S)-5-ethylsulfanyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-ethylsulfanyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 71114599 |
| Molecular Formula | C25H25FN6OS |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (11R,15S)-5-ethylsulfanyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CCSc1c2c(nn1Cc1ccc(-c3cccc(F)n3)cc1)N1C(=N[C@@H]3CCC[C@@H]31)N(C)C2=O |
| InChI | InChI=1S/C25H25FN6OS/c1-3-34-24-21-22(32-19-8-4-7-18(19)28-25(32)30(2)23(21)33)29-31(24)14-15-10-12-16(13-11-15)17-6-5-9-20(26)27-17/h5-6,9-13,18-19H,3-4,7-8,14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | HJLJTBLUYGEGCE-MOPGFXCFSA-N |
| XLogP | 4.43 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|