C10H12O5 — CID 71114628
(1S,2R,6R)-1-hydroxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-one (PubChem CID 71114628) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (1S,2R,6R)-1-hydroxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-one.
| Compound Name | (1S,2R,6R)-1-hydroxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-one |
|---|---|
| PubChem CID | 71114628 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (1S,2R,6R)-1-hydroxy-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-9-one |
| SMILES | CC1(C)O[C@H]2OC3C(=O)C=C[C@]3(O)[C@H]2O1 |
| InChI | InChI=1S/C10H12O5/c1-9(2)14-7-8(15-9)13-6-5(11)3-4-10(6,7)12/h3-4,6-8,12H,1-2H3/t6?,7-,8+,10+/m0/s1 |
| InChIKey | LLOBVYVNCKYUCW-NQHCQLFLSA-N |
| XLogP | -0.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |