C21H27N — CID 71114662
(4aR)-11,11-dimethyl-2,4a,5,6a,6b,9,10,10a,11a,12b-decahydro-1H-indeno[1,2-b]carbazole (PubChem CID 71114662) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is (4aR)-11,11-dimethyl-2,4a,5,6a,6b,9,10,10a,11a,12b-decahydro-1H-indeno[1,2-b]carbazole.
| Compound Name | (4aR)-11,11-dimethyl-2,4a,5,6a,6b,9,10,10a,11a,12b-decahydro-1H-indeno[1,2-b]carbazole |
|---|---|
| PubChem CID | 71114662 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (4aR)-11,11-dimethyl-2,4a,5,6a,6b,9,10,10a,11a,12b-decahydro-1H-indeno[1,2-b]carbazole |
| SMILES | CC1(C)C2C=C3C(=CC2C2C=CCCC21)N[C@@H]1C=CCCC31 |
| InChI | InChI=1S/C21H27N/c1-21(2)17-9-5-3-7-13(17)15-12-20-16(11-18(15)21)14-8-4-6-10-19(14)22-20/h3,6-7,10-15,17-19,22H,4-5,8-9H2,1-2H3/t13?,14?,15?,17?,18?,19-/m1/s1 |
| InChIKey | AHWARXRROVCFFT-FCBCEHCISA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|