About 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide
4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 71114674) has the molecular formula C17H9Cl2N5OS2
and a molecular weight of 434.33 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 71114674 |
| Molecular Formula | C17H9Cl2N5OS2 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1snnc1-c1ccc(Cl)cc1)c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H9Cl2N5OS2/c18-11-5-3-9(4-6-11)12-17(27-24-23-12)22-15(25)13-14(19)21-16(26-13)10-2-1-7-20-8-10/h1-8H,(H,22,25) |
| InChIKey | DDRMUSNHWFLSNE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (CID 71114674) is 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide is O=C(Nc1snnc1-c1ccc(Cl)cc1)c1sc(-c2cccnc2)nc1Cl.
What is the InChIKey of 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The InChIKey is DDRMUSNHWFLSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9Cl2N5OS2/c18-11-5-3-9(4-6-11)12-17(27-24-23-12)22-15(25)13-14(19)21-16(26-13)10-2-1-7-20-8-10/h1-8H,(H,22,25).
What are the key properties of 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide has a molecular weight of 434.33 g/mol, XLogP of 5.28, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[4-(4-chlorophenyl)thiadiazol-5-yl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 71114674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).