C28H34B2N2O4 — CID 71114705
2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-pyridin-2-ylpyridine (PubChem CID 71114705) has the molecular formula C28H34B2N2O4 and a molecular weight of 484.21 g/mol. Its IUPAC name is 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-pyridin-2-ylpyridine.
| Compound Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 71114705 |
| Molecular Formula | C28H34B2N2O4 |
| Molecular Weight | 484.21 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 2-[3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-pyridin-2-ylpyridine |
| SMILES | CC1(C)OB(c2cc(B3OC(C)(C)C(C)(C)O3)cc(-c3cccc(-c4ccccn4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C28H34B2N2O4/c1-25(2)26(3,4)34-29(33-25)20-16-19(17-21(18-20)30-35-27(5,6)28(7,8)36-30)22-13-11-14-24(32-22)23-12-9-10-15-31-23/h9-18H,1-8H3 |
| InChIKey | LLHLAUCHBSKPOT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|