C8H7BrF3NO2 — CID 71115050
1-(5-bromo-4-methyl-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol (PubChem CID 71115050) has the molecular formula C8H7BrF3NO2 and a molecular weight of 286.05 g/mol. Its IUPAC name is 1-(5-bromo-4-methyl-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-(5-bromo-4-methyl-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 71115050 |
| Molecular Formula | C8H7BrF3NO2 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | 1-(5-bromo-4-methyl-2-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
| SMILES | Cc1cc(C(O)(O)C(F)(F)F)ncc1Br |
| InChI | InChI=1S/C8H7BrF3NO2/c1-4-2-6(13-3-5(4)9)7(14,15)8(10,11)12/h2-3,14-15H,1H3 |
| InChIKey | KWSRXNYCFWQPOQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|