C21H19NO3 — CID 7111513
4-[(3aS,4R,9bR)-8-acetyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid (PubChem CID 7111513) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[(3aS,4R,9bR)-8-acetyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid.
| Compound Name | 4-[(3aS,4R,9bR)-8-acetyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 7111513 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[(3aS,4R,9bR)-8-acetyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl]benzoic acid |
| SMILES | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1[C@H](c1ccc(C(=O)O)cc1)N2 |
| InChI | InChI=1S/C21H19NO3/c1-12(23)15-9-10-19-18(11-15)16-3-2-4-17(16)20(22-19)13-5-7-14(8-6-13)21(24)25/h2-3,5-11,16-17,20,22H,4H2,1H3,(H,24,25)/t16-,17+,20+/m1/s1 |
| InChIKey | NXZMPSFMEMOYEX-UWVAXJGDSA-N |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|