C29H31N5O — CID 71115245
N-[3-(3-aminoisoquinolin-7-yl)-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide (PubChem CID 71115245) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[3-(3-aminoisoquinolin-7-yl)-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[3-(3-aminoisoquinolin-7-yl)-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 71115245 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[3-(3-aminoisoquinolin-7-yl)-4-methylphenyl]-4-[(4-methylpiperazin-1-yl)methyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1-c1ccc2cc(N)ncc2c1 |
| InChI | InChI=1S/C29H31N5O/c1-20-3-10-26(17-27(20)24-9-8-23-16-28(30)31-18-25(23)15-24)32-29(35)22-6-4-21(5-7-22)19-34-13-11-33(2)12-14-34/h3-10,15-18H,11-14,19H2,1-2H3,(H2,30,31)(H,32,35) |
| InChIKey | PLZYRMKHJIQAKJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |