C23H23N3O4 — CID 71115438
2-methoxyethyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate (PubChem CID 71115438) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-methoxyethyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate.
| Compound Name | 2-methoxyethyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
|---|---|
| PubChem CID | 71115438 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-methoxyethyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
| SMILES | COCCOC(=O)c1cccc(-c2cc(C(=O)Nc3ccncc3)ccc2CN)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-29-11-12-30-23(28)18-4-2-3-16(13-18)21-14-17(5-6-19(21)15-24)22(27)26-20-7-9-25-10-8-20/h2-10,13-14H,11-12,15,24H2,1H3,(H,25,26,27) |
| InChIKey | PLLPNOTWYJGSOE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|