C25H27N3O3 — CID 71115472
pentyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate (PubChem CID 71115472) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is pentyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate.
| Compound Name | pentyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
|---|---|
| PubChem CID | 71115472 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | pentyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
| SMILES | CCCCCOC(=O)c1cccc(-c2cc(C(=O)Nc3ccncc3)ccc2CN)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-2-3-4-14-31-25(30)20-7-5-6-18(15-20)23-16-19(8-9-21(23)17-26)24(29)28-22-10-12-27-13-11-22/h5-13,15-16H,2-4,14,17,26H2,1H3,(H,27,28,29) |
| InChIKey | YKXMTMJTVOENIT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|