C38H64N6O4Si2Sn — CID 71115645
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-trimethylstannyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 71115645) has the molecular formula C38H64N6O4Si2Sn and a molecular weight of 843.85 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-trimethylstannyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-trimethylstannyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 71115645 |
| Molecular Formula | C38H64N6O4Si2Sn |
| Molecular Weight | 843.85 g/mol |
| Exact Mass | 844.35 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-trimethylstannyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc([Sn](C)(C)C)nc4)c3n1)C2 |
| InChI | InChI=1S/C35H55N6O4Si2.3CH3.Sn/c1-35(2,3)45-34(42)40-28-12-13-29(40)20-27(19-28)31-21-32(41-33(38-31)30(23-37-41)26-11-10-14-36-22-26)39(24-43-15-17-46(4,5)6)25-44-16-18-47(7,8)9;;;;/h10-11,21-23,27-29H,12-13,15-20,24-25H2,1-9H3;3*1H3; |
| InChIKey | FLUAQJAHLVPZKJ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.85 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|