C26H44IN5O4Si2 — CID 71115700
(1S,5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 71115700) has the molecular formula C26H44IN5O4Si2 and a molecular weight of 673.74 g/mol. Its IUPAC name is (1S,5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 71115700 |
| Molecular Formula | C26H44IN5O4Si2 |
| Molecular Weight | 673.74 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | (1S,5R)-3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-iodopyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2C[C@H]3CC[C@@H](C2)N3C(=O)O)nc2c(I)cnn12 |
| InChI | InChI=1S/C26H44IN5O4Si2/c1-37(2,3)11-9-35-17-30(18-36-10-12-38(4,5)6)24-15-23(29-25-22(27)16-28-32(24)25)19-13-20-7-8-21(14-19)31(20)26(33)34/h15-16,19-21H,7-14,17-18H2,1-6H3,(H,33,34)/t19?,20-,21+ |
| InChIKey | FWLHZUKRPUSFRV-SEJPIABJSA-N |
| XLogP | 6.15 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|