C40H58FN7O4Si2 — CID 71115712
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-fluoro-2-pyridinyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 71115712) has the molecular formula C40H58FN7O4Si2 and a molecular weight of 776.12 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-fluoro-2-pyridinyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-fluoro-2-pyridinyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 71115712 |
| Molecular Formula | C40H58FN7O4Si2 |
| Molecular Weight | 776.12 g/mol |
| Exact Mass | 775.41 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(3-fluoro-2-pyridinyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(-c5ncccc5F)nc4)c3n1)C2 |
| InChI | InChI=1S/C40H58FN7O4Si2/c1-40(2,3)52-39(49)47-30-13-14-31(47)22-29(21-30)35-23-36(46(26-50-17-19-53(4,5)6)27-51-18-20-54(7,8)9)48-38(45-35)32(25-44-48)28-12-15-34(43-24-28)37-33(41)11-10-16-42-37/h10-12,15-16,23-25,29-31H,13-14,17-22,26-27H2,1-9H3 |
| InChIKey | LLEBHKLEQNTDMN-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 107.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.12 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|