About 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline
1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 71115925) has the molecular formula C20H18ClNO3S
and a molecular weight of 387.89 g/mol. Its IUPAC name is 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
| PubChem CID | 71115925 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | COc1ccc2c(Cl)c(C3=NCCc4cc(OC)c(OC)cc43)sc2c1 |
| InChI | InChI=1S/C20H18ClNO3S/c1-23-12-4-5-13-17(9-12)26-20(18(13)21)19-14-10-16(25-3)15(24-2)8-11(14)6-7-22-19/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | GNEWJCKIWMTIMZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline?
The IUPAC name of 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline (CID 71115925) is 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline?
The canonical SMILES for 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline is COc1ccc2c(Cl)c(C3=NCCc4cc(OC)c(OC)cc43)sc2c1.
What is the InChIKey of 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline?
The InChIKey is GNEWJCKIWMTIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClNO3S/c1-23-12-4-5-13-17(9-12)26-20(18(13)21)19-14-10-16(25-3)15(24-2)8-11(14)6-7-22-19/h4-5,8-10H,6-7H2,1-3H3.
What are the key properties of 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline?
1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline has a molecular weight of 387.89 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-6-methoxy-1-benzothiophen-2-yl)-6,7-dimethoxy-3,4-dihydroisoquinoline is sourced from PubChem (CID 71115925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).