About 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline
1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 71115961) has the molecular formula C19H18ClNS
and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 71115961 |
| Molecular Formula | C19H18ClNS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc2c(c1)CCN(C)C2c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H18ClNS/c1-12-7-8-14-13(11-12)9-10-21(2)18(14)19-17(20)15-5-3-4-6-16(15)22-19/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | VJDGPJQWEQSJGY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline (CID 71115961) is 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline is Cc1ccc2c(c1)CCN(C)C2c1sc2ccccc2c1Cl.
What is the InChIKey of 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is VJDGPJQWEQSJGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNS/c1-12-7-8-14-13(11-12)9-10-21(2)18(14)19-17(20)15-5-3-4-6-16(15)22-19/h3-8,11,18H,9-10H2,1-2H3.
What are the key properties of 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 327.88 g/mol, XLogP of 5.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-1-benzothiophen-2-yl)-2,6-dimethyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 71115961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).