C16H23FO — CID 71117110
(4-fluorophenyl)-[(1S,6S)-2,2,6-trimethylcyclohexyl]methanol (PubChem CID 71117110) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is (4-fluorophenyl)-[(1S,6S)-2,2,6-trimethylcyclohexyl]methanol.
| Compound Name | (4-fluorophenyl)-[(1S,6S)-2,2,6-trimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 71117110 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (4-fluorophenyl)-[(1S,6S)-2,2,6-trimethylcyclohexyl]methanol |
| SMILES | C[C@H]1CCCC(C)(C)[C@H]1C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FO/c1-11-5-4-10-16(2,3)14(11)15(18)12-6-8-13(17)9-7-12/h6-9,11,14-15,18H,4-5,10H2,1-3H3/t11-,14+,15?/m0/s1 |
| InChIKey | IDJOMMFILWJWBG-NFCBODTESA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |