C17H23FO — CID 71117226
(4-fluorophenyl)-[(1S)-1,2,2,6-tetramethylcyclohexyl]methanone (PubChem CID 71117226) has the molecular formula C17H23FO and a molecular weight of 262.37 g/mol. Its IUPAC name is (4-fluorophenyl)-[(1S)-1,2,2,6-tetramethylcyclohexyl]methanone.
| Compound Name | (4-fluorophenyl)-[(1S)-1,2,2,6-tetramethylcyclohexyl]methanone |
|---|---|
| PubChem CID | 71117226 |
| Molecular Formula | C17H23FO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (4-fluorophenyl)-[(1S)-1,2,2,6-tetramethylcyclohexyl]methanone |
| SMILES | CC1CCCC(C)(C)[C@@]1(C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FO/c1-12-6-5-11-16(2,3)17(12,4)15(19)13-7-9-14(18)10-8-13/h7-10,12H,5-6,11H2,1-4H3/t12?,17-/m1/s1 |
| InChIKey | MJADWTUNFXSBFJ-RGUGMKFQSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |