C27H27F3N2O4S — CID 71118215
4-[[(3aR,9S,9aS)-9-cyclopropyl-4-[4-(trifluoromethylsulfanyl)benzoyl]-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 71118215) has the molecular formula C27H27F3N2O4S and a molecular weight of 532.58 g/mol. Its IUPAC name is 4-[[(3aR,9S,9aS)-9-cyclopropyl-4-[4-(trifluoromethylsulfanyl)benzoyl]-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,9S,9aS)-9-cyclopropyl-4-[4-(trifluoromethylsulfanyl)benzoyl]-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71118215 |
| Molecular Formula | C27H27F3N2O4S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 4-[[(3aR,9S,9aS)-9-cyclopropyl-4-[4-(trifluoromethylsulfanyl)benzoyl]-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N[C@]1(C2CC2)c2ccccc2N(C(=O)c2ccc(SC(F)(F)F)cc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C27H27F3N2O4S/c28-27(29,30)37-18-12-8-16(9-13-18)25(36)32-21-6-2-1-4-19(21)26(17-10-11-17,20-5-3-7-22(20)32)31-23(33)14-15-24(34)35/h1-2,4,6,8-9,12-13,17,20,22H,3,5,7,10-11,14-15H2,(H,31,33)(H,34,35)/t20-,22+,26+/m0/s1 |
| InChIKey | AQRIYDLREJOQKG-UNIVCBNLSA-N |
| XLogP | 5.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |