About 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide
2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide (PubChem CID 71118294) has the molecular formula C15H12N6O2
and a molecular weight of 308.30 g/mol. Its IUPAC name is 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide |
| PubChem CID | 71118294 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1ncc2[nH]ccc2n1.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C8H6N2O.C7H6N4O/c11-8-7-4-2-1-3-6(7)5-9-10-8;8-6(12)7-10-3-5-4(11-7)1-2-9-5/h1-5H,(H,10,11);1-3,9H,(H2,8,12) |
| InChIKey | CEHJIPLOAHXEQS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide?
The IUPAC name of 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide (CID 71118294) is 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide.
What is the SMILES notation for 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide?
The canonical SMILES for 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide is NC(=O)c1ncc2[nH]ccc2n1.O=c1[nH]ncc2ccccc12.
What is the InChIKey of 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide?
The InChIKey is CEHJIPLOAHXEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C7H6N4O/c11-8-7-4-2-1-3-6(7)5-9-10-8;8-6(12)7-10-3-5-4(11-7)1-2-9-5/h1-5H,(H,10,11);1-3,9H,(H2,8,12).
What are the key properties of 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide?
2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide has a molecular weight of 308.30 g/mol, XLogP of 0.98, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-phthalazin-1-one;5H-pyrrolo[3,2-d]pyrimidine-2-carboxamide is sourced from PubChem (CID 71118294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).