C20H23FN2O5 — CID 71118578
9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-7-fluoro-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid (PubChem CID 71118578) has the molecular formula C20H23FN2O5 and a molecular weight of 390.41 g/mol. Its IUPAC name is 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-7-fluoro-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid.
| Compound Name | 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-7-fluoro-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 71118578 |
| Molecular Formula | C20H23FN2O5 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-7-fluoro-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid |
| SMILES | O=C(O)CCC(=O)C1(NC2c3cc(F)ccc3N(C(=O)O)C3CCCC23)CC1 |
| InChI | InChI=1S/C20H23FN2O5/c21-11-4-5-15-13(10-11)18(12-2-1-3-14(12)23(15)19(27)28)22-20(8-9-20)16(24)6-7-17(25)26/h4-5,10,12,14,18,22H,1-3,6-9H2,(H,25,26)(H,27,28) |
| InChIKey | RNJIADSTLCOGSU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |