C28H33N7O6 — CID 71118620
tert-butyl 5-[6-(4-methoxy-3-nitrophenyl)-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 71118620) has the molecular formula C28H33N7O6 and a molecular weight of 563.62 g/mol. Its IUPAC name is tert-butyl 5-[6-(4-methoxy-3-nitrophenyl)-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[6-(4-methoxy-3-nitrophenyl)-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71118620 |
| Molecular Formula | C28H33N7O6 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | tert-butyl 5-[6-(4-methoxy-3-nitrophenyl)-9-(oxan-2-yl)purin-2-yl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | COc1ccc(-c2nc(N3C=C4CN(C(=O)OC(C)(C)C)CC4C3)nc3c2ncn3C2CCCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H33N7O6/c1-28(2,3)41-27(36)33-14-18-12-32(13-19(18)15-33)26-30-23(17-8-9-21(39-4)20(11-17)35(37)38)24-25(31-26)34(16-29-24)22-7-5-6-10-40-22/h8-9,11-12,16,19,22H,5-7,10,13-15H2,1-4H3 |
| InChIKey | QOLWZVVRDVDMKM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 137.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|