C24H31F3N4O2 — CID 71119242
8-cyclopropyl-3,3-dimethyl-6-[(3R)-3-propan-2-yl-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 71119242) has the molecular formula C24H31F3N4O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 8-cyclopropyl-3,3-dimethyl-6-[(3R)-3-propan-2-yl-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 8-cyclopropyl-3,3-dimethyl-6-[(3R)-3-propan-2-yl-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 71119242 |
| Molecular Formula | C24H31F3N4O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 8-cyclopropyl-3,3-dimethyl-6-[(3R)-3-propan-2-yl-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | CC(C)[C@@H]1CN(c2nc(C3CC3)c3c(c2C#N)CC(C)(C)OC3)CCN1C(=O)CC(F)(F)F |
| InChI | InChI=1S/C24H31F3N4O2/c1-14(2)19-12-30(7-8-31(19)20(32)10-24(25,26)27)22-17(11-28)16-9-23(3,4)33-13-18(16)21(29-22)15-5-6-15/h14-15,19H,5-10,12-13H2,1-4H3/t19-/m0/s1 |
| InChIKey | KZPZXNCKRBSHGT-IBGZPJMESA-N |
| XLogP | 4.31 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |