C17H34N4 — CID 71119736
4-N-[3-[(4-aminocyclohexyl)amino]-2,2-dimethylpropyl]cyclohex-2-ene-1,4-diamine (PubChem CID 71119736) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 4-N-[3-[(4-aminocyclohexyl)amino]-2,2-dimethylpropyl]cyclohex-2-ene-1,4-diamine.
| Compound Name | 4-N-[3-[(4-aminocyclohexyl)amino]-2,2-dimethylpropyl]cyclohex-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 71119736 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 4-N-[3-[(4-aminocyclohexyl)amino]-2,2-dimethylpropyl]cyclohex-2-ene-1,4-diamine |
| SMILES | CC(C)(CNC1C=CC(N)CC1)CNC1CCC(N)CC1 |
| InChI | InChI=1S/C17H34N4/c1-17(2,11-20-15-7-3-13(18)4-8-15)12-21-16-9-5-14(19)6-10-16/h3,7,13-16,20-21H,4-6,8-12,18-19H2,1-2H3 |
| InChIKey | ONQPLOIURWKVKL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|