C17H27N — CID 71119974
3,7,7,12,13-pentamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene (PubChem CID 71119974) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 3,7,7,12,13-pentamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene.
| Compound Name | 3,7,7,12,13-pentamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene |
|---|---|
| PubChem CID | 71119974 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 3,7,7,12,13-pentamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene |
| SMILES | CC1C2C=CC3=C(C1C2C)N(C)CCCC3(C)C |
| InChI | InChI=1S/C17H27N/c1-11-13-7-8-14-16(15(11)12(13)2)18(5)10-6-9-17(14,3)4/h7-8,11-13,15H,6,9-10H2,1-5H3 |
| InChIKey | DNQVZSBTXCIMFO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |