C18H29N — CID 71119978
(6R)-3,6,7,7,12,13-hexamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene (PubChem CID 71119978) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (6R)-3,6,7,7,12,13-hexamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene.
| Compound Name | (6R)-3,6,7,7,12,13-hexamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene |
|---|---|
| PubChem CID | 71119978 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (6R)-3,6,7,7,12,13-hexamethyl-3-azatricyclo[9.1.1.02,8]trideca-2(8),9-diene |
| SMILES | CC1C2C=CC3=C(C1C2C)N(C)CC[C@@H](C)C3(C)C |
| InChI | InChI=1S/C18H29N/c1-11-9-10-19(6)17-15(18(11,4)5)8-7-14-12(2)16(17)13(14)3/h7-8,11-14,16H,9-10H2,1-6H3/t11-,12?,13?,14?,16?/m1/s1 |
| InChIKey | NRPZWCFNLSJPFN-UWJCENJNSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |