C19H35N — CID 71119994
(4R)-6-[(Z)-5,5-dimethylhex-1-enyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine (PubChem CID 71119994) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (4R)-6-[(Z)-5,5-dimethylhex-1-enyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine.
| Compound Name | (4R)-6-[(Z)-5,5-dimethylhex-1-enyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 71119994 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (4R)-6-[(Z)-5,5-dimethylhex-1-enyl]-1,4,5,5,7-pentamethyl-3,4-dihydro-2H-azepine |
| SMILES | CC1=C(/C=C\CCC(C)(C)C)C(C)(C)[C@H](C)CCN1C |
| InChI | InChI=1S/C19H35N/c1-15-12-14-20(8)16(2)17(19(15,6)7)11-9-10-13-18(3,4)5/h9,11,15H,10,12-14H2,1-8H3/b11-9-/t15-/m1/s1 |
| InChIKey | GUZAJVJIICSZPA-ZHUYAKLQSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |