C18H33N — CID 71119998
6-[(Z)-4,6-dimethylhept-1-enyl]-5,5,7-trimethyl-1,2,3,4-tetrahydroazepine (PubChem CID 71119998) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 6-[(Z)-4,6-dimethylhept-1-enyl]-5,5,7-trimethyl-1,2,3,4-tetrahydroazepine.
| Compound Name | 6-[(Z)-4,6-dimethylhept-1-enyl]-5,5,7-trimethyl-1,2,3,4-tetrahydroazepine |
|---|---|
| PubChem CID | 71119998 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 6-[(Z)-4,6-dimethylhept-1-enyl]-5,5,7-trimethyl-1,2,3,4-tetrahydroazepine |
| SMILES | CC1=C(/C=C\CC(C)CC(C)C)C(C)(C)CCCN1 |
| InChI | InChI=1S/C18H33N/c1-14(2)13-15(3)9-7-10-17-16(4)19-12-8-11-18(17,5)6/h7,10,14-15,19H,8-9,11-13H2,1-6H3/b10-7- |
| InChIKey | QDYJUXIODYSEDB-YFHOEESVSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |