C26H50O2Si — CID 71120336
(2E)-2-[(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol (PubChem CID 71120336) has the molecular formula C26H50O2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is (2E)-2-[(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol.
| Compound Name | (2E)-2-[(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
|---|---|
| PubChem CID | 71120336 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | (2E)-2-[(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanol |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@@H](C)C1CCC2/C(=C/CO)CCC[C@@]21C |
| InChI | InChI=1S/C26H50O2Si/c1-8-29(9-2,10-3)28-25(5,6)18-11-13-21(4)23-15-16-24-22(17-20-27)14-12-19-26(23,24)7/h17,21,23-24,27H,8-16,18-20H2,1-7H3/b22-17+/t21-,23?,24?,26-/m1/s1 |
| InChIKey | FSKLEQVJMLOUCB-UTCZQRPNSA-N |
| XLogP | 7.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|