C17H20F2O — CID 71120419
2-(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)-5-propyl-3,6-dihydro-2H-pyran (PubChem CID 71120419) has the molecular formula C17H20F2O and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)-5-propyl-3,6-dihydro-2H-pyran.
| Compound Name | 2-(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)-5-propyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 71120419 |
| Molecular Formula | C17H20F2O |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-(5,6-difluoro-2,3-dihydro-1H-inden-2-yl)-5-propyl-3,6-dihydro-2H-pyran |
| SMILES | CCCC1=CCC(C2Cc3cc(F)c(F)cc3C2)OC1 |
| InChI | InChI=1S/C17H20F2O/c1-2-3-11-4-5-17(20-10-11)14-6-12-8-15(18)16(19)9-13(12)7-14/h4,8-9,14,17H,2-3,5-7,10H2,1H3 |
| InChIKey | FKHZRPLSQISDCW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|