C14H23FNO2P — CID 71120544
1-[2-fluoro-6-[2-methyl-3-(methylphosphanylamino)propyl]phenoxy]propan-2-ol (PubChem CID 71120544) has the molecular formula C14H23FNO2P and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-[2-fluoro-6-[2-methyl-3-(methylphosphanylamino)propyl]phenoxy]propan-2-ol.
| Compound Name | 1-[2-fluoro-6-[2-methyl-3-(methylphosphanylamino)propyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 71120544 |
| Molecular Formula | C14H23FNO2P |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-[2-fluoro-6-[2-methyl-3-(methylphosphanylamino)propyl]phenoxy]propan-2-ol |
| SMILES | CPNCC(C)Cc1cccc(F)c1OCC(C)O |
| InChI | InChI=1S/C14H23FNO2P/c1-10(8-16-19-3)7-12-5-4-6-13(15)14(12)18-9-11(2)17/h4-6,10-11,16-17,19H,7-9H2,1-3H3 |
| InChIKey | IUYRKTDFYLYUPU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|