C28H38N2O2S2 — CID 71120704
3-[[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-4,5-dihydro-1,3-thiazol-2-yl]methylsulfanyl]propanoic acid (PubChem CID 71120704) has the molecular formula C28H38N2O2S2 and a molecular weight of 498.76 g/mol. Its IUPAC name is 3-[[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-4,5-dihydro-1,3-thiazol-2-yl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-4,5-dihydro-1,3-thiazol-2-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 71120704 |
| Molecular Formula | C28H38N2O2S2 |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 3-[[4-[4-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]-4,5-dihydro-1,3-thiazol-2-yl]methylsulfanyl]propanoic acid |
| SMILES | CCC(CC)c1ccc(N(Cc2ccc(C3CSC(CSCCC(=O)O)=N3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C28H38N2O2S2/c1-5-22(6-2)23-11-13-25(14-12-23)30(20(3)4)17-21-7-9-24(10-8-21)26-18-34-27(29-26)19-33-16-15-28(31)32/h7-14,20,22,26H,5-6,15-19H2,1-4H3,(H,31,32) |
| InChIKey | AVEYIWKNGUGMQJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|