C7H10N2O3S2 — CID 71120897
5-[2-(1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione (PubChem CID 71120897) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-[2-(1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione.
| Compound Name | 5-[2-(1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione |
|---|---|
| PubChem CID | 71120897 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 5-[2-(1,3-dioxolan-4-yl)ethoxy]-1,2,4-thiadiazole-3-thione |
| SMILES | S=c1nc(OCCC2COCO2)s[nH]1 |
| InChI | InChI=1S/C7H10N2O3S2/c13-6-8-7(14-9-6)11-2-1-5-3-10-4-12-5/h5H,1-4H2,(H,9,13) |
| InChIKey | DKBRVAJNKSBOJM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|