C14H25FN2O6 — CID 71120937
(3S,6R)-N-butyl-6-[[[(2S)-2-fluoropropanoyl]amino]methyl]-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 71120937) has the molecular formula C14H25FN2O6 and a molecular weight of 336.36 g/mol. Its IUPAC name is (3S,6R)-N-butyl-6-[[[(2S)-2-fluoropropanoyl]amino]methyl]-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (3S,6R)-N-butyl-6-[[[(2S)-2-fluoropropanoyl]amino]methyl]-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 71120937 |
| Molecular Formula | C14H25FN2O6 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (3S,6R)-N-butyl-6-[[[(2S)-2-fluoropropanoyl]amino]methyl]-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | CCCCNC(=O)C1O[C@H](CNC(=O)[C@H](C)F)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H25FN2O6/c1-3-4-5-16-14(22)12-11(20)10(19)9(18)8(23-12)6-17-13(21)7(2)15/h7-12,18-20H,3-6H2,1-2H3,(H,16,22)(H,17,21)/t7-,8+,9?,10?,11-,12?/m0/s1 |
| InChIKey | AOITUEFUSLONBA-NCTMPGRTSA-N |
| XLogP | -1.77 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|