About 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione
7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 71121075) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| PubChem CID | 71121075 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCCN1C=NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H18N4O2/c1-4-5-6-15-7-12-9-8(15)10(16)14(3)11(17)13(9)2/h7-9H,4-6H2,1-3H3 |
| InChIKey | JFFCQLZOGOAQGP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The IUPAC name of 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione (CID 71121075) is 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
What is the SMILES notation for 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The canonical SMILES for 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione is CCCCN1C=NC2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
The InChIKey is JFFCQLZOGOAQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-4-5-6-15-7-12-9-8(15)10(16)14(3)11(17)13(9)2/h7-9H,4-6H2,1-3H3.
What are the key properties of 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione?
7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione has a molecular weight of 238.29 g/mol, XLogP of 0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-1,3-dimethyl-4,5-dihydropurine-2,6-dione is sourced from PubChem (CID 71121075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).