C24H27ClN5O2S3+ — CID 71122189
(2Z,5Z)-2-[4-[(6-chloro-3-methyl-4,5-dihydro-1,3-benzothiazol-3-ium-2-yl)imino]-5-ethyl-1,3,5-oxathiazinan-2-ylidene]-3-ethyl-5-(1-methyl-2-pyridinylidene)-1,3-thiazolidin-4-one (PubChem CID 71122189) has the molecular formula C24H27ClN5O2S3+ and a molecular weight of 549.17 g/mol. Its IUPAC name is (2Z,5Z)-2-[4-[(6-chloro-3-methyl-4,5-dihydro-1,3-benzothiazol-3-ium-2-yl)imino]-5-ethyl-1,3,5-oxathiazinan-2-ylidene]-3-ethyl-5-(1-methyl-2-pyridinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5Z)-2-[4-[(6-chloro-3-methyl-4,5-dihydro-1,3-benzothiazol-3-ium-2-yl)imino]-5-ethyl-1,3,5-oxathiazinan-2-ylidene]-3-ethyl-5-(1-methyl-2-pyridinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71122189 |
| Molecular Formula | C24H27ClN5O2S3+ |
| Molecular Weight | 549.17 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | (2Z,5Z)-2-[4-[(6-chloro-3-methyl-4,5-dihydro-1,3-benzothiazol-3-ium-2-yl)imino]-5-ethyl-1,3,5-oxathiazinan-2-ylidene]-3-ethyl-5-(1-methyl-2-pyridinylidene)-1,3-thiazolidin-4-one |
| SMILES | CCN1CO/C(=c2/s/c(=C3/C=CC=CN3C)c(=O)n2CC)SC1=Nc1sc2c([n+]1C)CCC(Cl)=C2 |
| InChI | InChI=1S/C24H27ClN5O2S3/c1-5-29-14-32-22(21-30(6-2)20(31)19(34-21)17-9-7-8-12-27(17)3)35-24(29)26-23-28(4)16-11-10-15(25)13-18(16)33-23/h7-9,12-13H,5-6,10-11,14H2,1-4H3/q+1/b19-17-,22-21- |
| InChIKey | UECASVGLYMPXFN-RRFGMPLOSA-N |
| XLogP | 3.26 |
| TPSA | 53.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|