C22H28NO+ — CID 7112219
(2R,3R,4R,6S)-3-ethyl-2,6-diphenyl-4-prop-2-enylpiperidin-1-ium-4-ol (PubChem CID 7112219) has the molecular formula C22H28NO+ and a molecular weight of 322.47 g/mol. Its IUPAC name is (2R,3R,4R,6S)-3-ethyl-2,6-diphenyl-4-prop-2-enylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3R,4R,6S)-3-ethyl-2,6-diphenyl-4-prop-2-enylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7112219 |
| Molecular Formula | C22H28NO+ |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (2R,3R,4R,6S)-3-ethyl-2,6-diphenyl-4-prop-2-enylpiperidin-1-ium-4-ol |
| SMILES | C=CC[C@@]1(O)C[C@@H](c2ccccc2)[NH2+][C@@H](c2ccccc2)[C@H]1CC |
| InChI | InChI=1S/C22H27NO/c1-3-15-22(24)16-20(17-11-7-5-8-12-17)23-21(19(22)4-2)18-13-9-6-10-14-18/h3,5-14,19-21,23-24H,1,4,15-16H2,2H3/p+1/t19-,20+,21+,22-/m1/s1 |
| InChIKey | CSTHTSWEEQLRRV-CLAROIROSA-O |
| XLogP | 3.77 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|