C21H35NO4Si — CID 71122367
tert-butyl (1R,3S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate (PubChem CID 71122367) has the molecular formula C21H35NO4Si and a molecular weight of 393.60 g/mol. Its IUPAC name is tert-butyl (1R,3S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate.
| Compound Name | tert-butyl (1R,3S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
|---|---|
| PubChem CID | 71122367 |
| Molecular Formula | C21H35NO4Si |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl (1R,3S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2C(C1CO[Si](C)(C)C(C)(C)C)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H35NO4Si/c1-20(2,3)26-19(24)22-15(12-25-27(7,8)21(4,5)6)16-13-9-10-14(11-13)17(16)18(22)23/h9-10,13-17H,11-12H2,1-8H3/t13-,14+,15?,16?,17?/m0/s1 |
| InChIKey | MOKQTIZIYNBWTA-KPLZDEIPSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|