C13H24F3NO — CID 71122372
N-(1-ethoxy-2,2,2-trifluoroethyl)cyclononanamine (PubChem CID 71122372) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(1-ethoxy-2,2,2-trifluoroethyl)cyclononanamine.
| Compound Name | N-(1-ethoxy-2,2,2-trifluoroethyl)cyclononanamine |
|---|---|
| PubChem CID | 71122372 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-(1-ethoxy-2,2,2-trifluoroethyl)cyclononanamine |
| SMILES | CCOC(NC1CCCCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H24F3NO/c1-2-18-12(13(14,15)16)17-11-9-7-5-3-4-6-8-10-11/h11-12,17H,2-10H2,1H3 |
| InChIKey | NGTUOOMSRKWRBL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|