About 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine
4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine (PubChem CID 71122389) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine |
| PubChem CID | 71122389 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine |
| SMILES | CC(C)(C)[C@H]1NCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C12H24N2O/c1-12(2,3)11-10(4-5-13-11)14-6-8-15-9-7-14/h10-11,13H,4-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | ZWKIXYKGSMSION-QWRGUYRKSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine?
The IUPAC name of 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine (CID 71122389) is 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine.
What is the SMILES notation for 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine?
The canonical SMILES for 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine is CC(C)(C)[C@H]1NCC[C@@H]1N1CCOCC1.
What is the InChIKey of 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine?
The InChIKey is ZWKIXYKGSMSION-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H24N2O/c1-12(2,3)11-10(4-5-13-11)14-6-8-15-9-7-14/h10-11,13H,4-9H2,1-3H3/t10-,11-/m0/s1.
What are the key properties of 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine?
4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine has a molecular weight of 212.34 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3S)-2-tert-butylpyrrolidin-3-yl]morpholine is sourced from PubChem (CID 71122389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).