C19H33NO4 — CID 71122464
2-[3,5-dimethyl-3,5-bis(2-methylbutan-2-yl)-2,6-dioxopiperidin-1-yl]acetic acid (PubChem CID 71122464) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[3,5-dimethyl-3,5-bis(2-methylbutan-2-yl)-2,6-dioxopiperidin-1-yl]acetic acid.
| Compound Name | 2-[3,5-dimethyl-3,5-bis(2-methylbutan-2-yl)-2,6-dioxopiperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 71122464 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 2-[3,5-dimethyl-3,5-bis(2-methylbutan-2-yl)-2,6-dioxopiperidin-1-yl]acetic acid |
| SMILES | CCC(C)(C)C1(C)CC(C)(C(C)(C)CC)C(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C19H33NO4/c1-9-16(3,4)18(7)12-19(8,17(5,6)10-2)15(24)20(14(18)23)11-13(21)22/h9-12H2,1-8H3,(H,21,22) |
| InChIKey | AOOIGZZOQYRGGV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|