C8H18NO5P — CID 71122648
[(2S)-1-(3-hydroxypropyl)pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 71122648) has the molecular formula C8H18NO5P and a molecular weight of 239.21 g/mol. Its IUPAC name is [(2S)-1-(3-hydroxypropyl)pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S)-1-(3-hydroxypropyl)pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71122648 |
| Molecular Formula | C8H18NO5P |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [(2S)-1-(3-hydroxypropyl)pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@@H]1CCCN1CCCO |
| InChI | InChI=1S/C8H18NO5P/c10-6-2-5-9-4-1-3-8(9)7-14-15(11,12)13/h8,10H,1-7H2,(H2,11,12,13)/t8-/m0/s1 |
| InChIKey | MOMZUVXCLZFPPD-QMMMGPOBSA-N |
| XLogP | -0.06 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|