C19H24F3N3O5 — CID 71122751
tert-butyl (4S)-5-[2-[3-nitro-5-(trifluoromethyl)phenoxy]ethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 71122751) has the molecular formula C19H24F3N3O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is tert-butyl (4S)-5-[2-[3-nitro-5-(trifluoromethyl)phenoxy]ethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (4S)-5-[2-[3-nitro-5-(trifluoromethyl)phenoxy]ethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 71122751 |
| Molecular Formula | C19H24F3N3O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | tert-butyl (4S)-5-[2-[3-nitro-5-(trifluoromethyl)phenoxy]ethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC1CN2CCOc1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N3O5/c1-18(2,3)30-17(26)24-11-14-8-15(24)10-23(14)4-5-29-16-7-12(19(20,21)22)6-13(9-16)25(27)28/h6-7,9,14-15H,4-5,8,10-11H2,1-3H3/t14-,15?/m0/s1 |
| InChIKey | KDATXLGPKBKNOS-MLCCFXAWSA-N |
| XLogP | 3.69 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|