About 1-(4-bromophenyl)-2,4,5-triphenylimidazole
1-(4-bromophenyl)-2,4,5-triphenylimidazole (PubChem CID 71122850) has the molecular formula C27H19BrN2
and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,4,5-triphenylimidazole.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2,4,5-triphenylimidazole |
| PubChem CID | 71122850 |
| Molecular Formula | C27H19BrN2 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-(4-bromophenyl)-2,4,5-triphenylimidazole |
| SMILES | Brc1ccc(-n2c(-c3ccccc3)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19BrN2/c28-23-16-18-24(19-17-23)30-26(21-12-6-2-7-13-21)25(20-10-4-1-5-11-20)29-27(30)22-14-8-3-9-15-22/h1-19H |
| InChIKey | NFMWHZLCIOIGFU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-2,4,5-triphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2,4,5-triphenylimidazole?
The IUPAC name of 1-(4-bromophenyl)-2,4,5-triphenylimidazole (CID 71122850) is 1-(4-bromophenyl)-2,4,5-triphenylimidazole.
What is the SMILES notation for 1-(4-bromophenyl)-2,4,5-triphenylimidazole?
The canonical SMILES for 1-(4-bromophenyl)-2,4,5-triphenylimidazole is Brc1ccc(-n2c(-c3ccccc3)nc(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2,4,5-triphenylimidazole?
The InChIKey is NFMWHZLCIOIGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19BrN2/c28-23-16-18-24(19-17-23)30-26(21-12-6-2-7-13-21)25(20-10-4-1-5-11-20)29-27(30)22-14-8-3-9-15-22/h1-19H.
What are the key properties of 1-(4-bromophenyl)-2,4,5-triphenylimidazole?
1-(4-bromophenyl)-2,4,5-triphenylimidazole has a molecular weight of 451.37 g/mol, XLogP of 7.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2,4,5-triphenylimidazole is sourced from PubChem (CID 71122850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).