C21H23NO2 — CID 71122906
3-benzyl-4-(3-methylbutan-2-yl)-5-phenyl-1,3-oxazol-2-one (PubChem CID 71122906) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-benzyl-4-(3-methylbutan-2-yl)-5-phenyl-1,3-oxazol-2-one.
| Compound Name | 3-benzyl-4-(3-methylbutan-2-yl)-5-phenyl-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 71122906 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-benzyl-4-(3-methylbutan-2-yl)-5-phenyl-1,3-oxazol-2-one |
| SMILES | CC(C)C(C)c1c(-c2ccccc2)oc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-15(2)16(3)19-20(18-12-8-5-9-13-18)24-21(23)22(19)14-17-10-6-4-7-11-17/h4-13,15-16H,14H2,1-3H3 |
| InChIKey | PLUDTDINSAKOEG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |