About 10-propyl-9H-acridine
10-propyl-9H-acridine (PubChem CID 71122947) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is 10-propyl-9H-acridine.
Molecular Properties
| Compound Name | 10-propyl-9H-acridine |
| PubChem CID | 71122947 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 10-propyl-9H-acridine |
| SMILES | CCCN1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C16H17N/c1-2-11-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17/h3-10H,2,11-12H2,1H3 |
| InChIKey | JJXBNMYPLOCBSR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-propyl-9H-acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-propyl-9H-acridine?
The IUPAC name of 10-propyl-9H-acridine (CID 71122947) is 10-propyl-9H-acridine.
What is the SMILES notation for 10-propyl-9H-acridine?
The canonical SMILES for 10-propyl-9H-acridine is CCCN1c2ccccc2Cc2ccccc21.
What is the InChIKey of 10-propyl-9H-acridine?
The InChIKey is JJXBNMYPLOCBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N/c1-2-11-17-15-9-5-3-7-13(15)12-14-8-4-6-10-16(14)17/h3-10H,2,11-12H2,1H3.
What are the key properties of 10-propyl-9H-acridine?
10-propyl-9H-acridine has a molecular weight of 223.32 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-propyl-9H-acridine is sourced from PubChem (CID 71122947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).