About carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine
carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine (PubChem CID 71122962) has the molecular formula C13H19LrN3-4
and a molecular weight of 479.32 g/mol. Its IUPAC name is carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine.
Molecular Properties
| Compound Name | carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine |
| PubChem CID | 71122962 |
| Molecular Formula | C13H19LrN3-4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine |
| SMILES | CN1C=CN(c2[c-]cc(CN)cc2)[CH-]1.[CH3-].[CH3-].[Lr] |
| InChI | InChI=1S/C11H13N3.2CH3.Lr/c1-13-6-7-14(9-13)11-4-2-10(8-12)3-5-11;;;/h2-4,6-7,9H,8,12H2,1H3;2*1H3;/q-2;2*-1; |
| InChIKey | TXFNXFAQYJKKLU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine?
The IUPAC name of carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine (CID 71122962) is carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine.
What is the SMILES notation for carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine?
The canonical SMILES for carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine is CN1C=CN(c2[c-]cc(CN)cc2)[CH-]1.[CH3-].[CH3-].[Lr].
What is the InChIKey of carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine?
The InChIKey is TXFNXFAQYJKKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3.2CH3.Lr/c1-13-6-7-14(9-13)11-4-2-10(8-12)3-5-11;;;/h2-4,6-7,9H,8,12H2,1H3;2*1H3;/q-2;2*-1;.
What are the key properties of carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine?
carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine has a molecular weight of 479.32 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;lawrencium;[4-(3-methyl-2H-imidazol-2-id-1-yl)benzene-5-id-1-yl]methanamine is sourced from PubChem (CID 71122962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).