C30H30N2 — CID 71123585
N-(2,4,6-trimethylphenyl)-2-(2,4,6-trimethylphenyl)imino-1H-acenaphthylen-1-amine (PubChem CID 71123585) has the molecular formula C30H30N2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)-2-(2,4,6-trimethylphenyl)imino-1H-acenaphthylen-1-amine.
| Compound Name | N-(2,4,6-trimethylphenyl)-2-(2,4,6-trimethylphenyl)imino-1H-acenaphthylen-1-amine |
|---|---|
| PubChem CID | 71123585 |
| Molecular Formula | C30H30N2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)-2-(2,4,6-trimethylphenyl)imino-1H-acenaphthylen-1-amine |
| SMILES | Cc1cc(C)c(/N=C2\c3cccc4cccc(c34)C2Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C30H30N2/c1-17-13-19(3)27(20(4)14-17)31-29-24-11-7-9-23-10-8-12-25(26(23)24)30(29)32-28-21(5)15-18(2)16-22(28)6/h7-16,29,31H,1-6H3/b32-30+ |
| InChIKey | XHDSTVHDAULXAD-NHQGMKOOSA-N |
| XLogP | 7.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|