C19H26O7S — CID 71123618
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 71123618) has the molecular formula C19H26O7S and a molecular weight of 398.48 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 71123618 |
| Molecular Formula | C19H26O7S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6-(4-methylphenyl)sulfonyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | Cc1ccc(S(=O)(=O)C2C(C3COC(C)(C)O3)OC3OC(C)(C)OC32)cc1 |
| InChI | InChI=1S/C19H26O7S/c1-11-6-8-12(9-7-11)27(20,21)16-14(13-10-22-18(2,3)24-13)23-17-15(16)25-19(4,5)26-17/h6-9,13-17H,10H2,1-5H3 |
| InChIKey | HPISNYVOPFKXEF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |